About [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate
[(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate (PubChem CID 6383144) has the molecular formula C20H16N2O3
and a molecular weight of 332.36 g/mol. Its IUPAC name is [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate |
| PubChem CID | 6383144 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O/N=C(/c2ccccc2)c2ccncc2)cc1 |
| InChI | InChI=1S/C20H16N2O3/c1-24-18-9-7-17(8-10-18)20(23)25-22-19(15-5-3-2-4-6-15)16-11-13-21-14-12-16/h2-14H,1H3/b22-19- |
| InChIKey | TWZZGFWXLCVVQI-QOCHGBHMSA-N |
| XLogP | 3.70 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate?
The IUPAC name of [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate (CID 6383144) is [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate.
What is the SMILES notation for [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate?
The canonical SMILES for [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate is COc1ccc(C(=O)O/N=C(/c2ccccc2)c2ccncc2)cc1.
What is the InChIKey of [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate?
The InChIKey is TWZZGFWXLCVVQI-QOCHGBHMSA-N. The full InChI is InChI=1S/C20H16N2O3/c1-24-18-9-7-17(8-10-18)20(23)25-22-19(15-5-3-2-4-6-15)16-11-13-21-14-12-16/h2-14H,1H3/b22-19-.
What are the key properties of [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate?
[(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate has a molecular weight of 332.36 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[phenyl(pyridin-4-yl)methylidene]amino] 4-methoxybenzoate is sourced from PubChem (CID 6383144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).