C12H12FN3OS — CID 63831827
4-amino-3-fluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 63831827) has the molecular formula C12H12FN3OS and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-amino-3-fluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide.
| Compound Name | 4-amino-3-fluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 63831827 |
| Molecular Formula | C12H12FN3OS |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-amino-3-fluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCCc2cscn2)cc1F |
| InChI | InChI=1S/C12H12FN3OS/c13-10-5-8(1-2-11(10)14)12(17)15-4-3-9-6-18-7-16-9/h1-2,5-7H,3-4,14H2,(H,15,17) |
| InChIKey | YFOFIAFYLYVCCR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|