C10H9N5O2S2 — CID 63831888
5-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 63831888) has the molecular formula C10H9N5O2S2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 5-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 63831888 |
| Molecular Formula | C10H9N5O2S2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NCCc2cscn2)nc2sccn12 |
| InChI | InChI=1S/C10H9N5O2S2/c16-15(17)9-8(13-10-14(9)3-4-19-10)11-2-1-7-5-18-6-12-7/h3-6,11H,1-2H2 |
| InChIKey | CXSSBSKBDZWWQC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|