About N,N,2-trimethylbuta-1,3-dien-1-amine
N,N,2-trimethylbuta-1,3-dien-1-amine (PubChem CID 638323) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is N,N,2-trimethylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N,N,2-trimethylbuta-1,3-dien-1-amine |
| PubChem CID | 638323 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | N,N,2-trimethylbuta-1,3-dien-1-amine |
| SMILES | C=CC(C)=CN(C)C |
| InChI | InChI=1S/C7H13N/c1-5-7(2)6-8(3)4/h5-6H,1H2,2-4H3 |
| InChIKey | LWYIQUBQKVMOHO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,N,2-trimethylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trimethylbuta-1,3-dien-1-amine?
The IUPAC name of N,N,2-trimethylbuta-1,3-dien-1-amine (CID 638323) is N,N,2-trimethylbuta-1,3-dien-1-amine.
What is the SMILES notation for N,N,2-trimethylbuta-1,3-dien-1-amine?
The canonical SMILES for N,N,2-trimethylbuta-1,3-dien-1-amine is C=CC(C)=CN(C)C.
What is the InChIKey of N,N,2-trimethylbuta-1,3-dien-1-amine?
The InChIKey is LWYIQUBQKVMOHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N/c1-5-7(2)6-8(3)4/h5-6H,1H2,2-4H3.
What are the key properties of N,N,2-trimethylbuta-1,3-dien-1-amine?
N,N,2-trimethylbuta-1,3-dien-1-amine has a molecular weight of 111.19 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trimethylbuta-1,3-dien-1-amine is sourced from PubChem (CID 638323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).