About N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine
N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine (PubChem CID 63832362) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine |
| PubChem CID | 63832362 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine |
| SMILES | CCNC(CC(C)C(C)(C)C)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C19H33NO/c1-8-20-18(13-15(4)19(5,6)7)16-9-11-17(12-10-16)21-14(2)3/h9-12,14-15,18,20H,8,13H2,1-7H3 |
| InChIKey | OLNRMHGUAPXZQI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine?
The IUPAC name of N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine (CID 63832362) is N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine.
What is the SMILES notation for N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine?
The canonical SMILES for N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine is CCNC(CC(C)C(C)(C)C)c1ccc(OC(C)C)cc1.
What is the InChIKey of N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine?
The InChIKey is OLNRMHGUAPXZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO/c1-8-20-18(13-15(4)19(5,6)7)16-9-11-17(12-10-16)21-14(2)3/h9-12,14-15,18,20H,8,13H2,1-7H3.
What are the key properties of N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine?
N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine has a molecular weight of 291.48 g/mol, XLogP of 5.20, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,4,4-trimethyl-1-(4-propan-2-yloxyphenyl)pentan-1-amine is sourced from PubChem (CID 63832362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).