C13H29N3O2S — CID 63832630
3-[4-(3-methylbutylsulfonyl)-1,4-diazepan-1-yl]propan-1-amine (PubChem CID 63832630) has the molecular formula C13H29N3O2S and a molecular weight of 291.46 g/mol. Its IUPAC name is 3-[4-(3-methylbutylsulfonyl)-1,4-diazepan-1-yl]propan-1-amine.
| Compound Name | 3-[4-(3-methylbutylsulfonyl)-1,4-diazepan-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 63832630 |
| Molecular Formula | C13H29N3O2S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3-[4-(3-methylbutylsulfonyl)-1,4-diazepan-1-yl]propan-1-amine |
| SMILES | CC(C)CCS(=O)(=O)N1CCCN(CCCN)CC1 |
| InChI | InChI=1S/C13H29N3O2S/c1-13(2)5-12-19(17,18)16-9-4-8-15(10-11-16)7-3-6-14/h13H,3-12,14H2,1-2H3 |
| InChIKey | WYOCSJHHPDKONG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |