C12H17F3N4O2 — CID 63832909
5-amino-2-propan-2-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4-carboxamide (PubChem CID 63832909) has the molecular formula C12H17F3N4O2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 5-amino-2-propan-2-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4-carboxamide.
| Compound Name | 5-amino-2-propan-2-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 63832909 |
| Molecular Formula | C12H17F3N4O2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 5-amino-2-propan-2-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4-carboxamide |
| SMILES | CC(C)c1ncc(N)c(C(=O)NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N4O2/c1-7(2)10-18-5-8(16)9(19-10)11(20)17-3-4-21-6-12(13,14)15/h5,7H,3-4,6,16H2,1-2H3,(H,17,20) |
| InChIKey | MSOMTOUMGBMKJH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|