C17H28N2O — CID 63833207
N-[(3-aminophenyl)methyl]-N-ethyl-3,4,4-trimethylpentanamide (PubChem CID 63833207) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-N-ethyl-3,4,4-trimethylpentanamide.
| Compound Name | N-[(3-aminophenyl)methyl]-N-ethyl-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 63833207 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-N-ethyl-3,4,4-trimethylpentanamide |
| SMILES | CCN(Cc1cccc(N)c1)C(=O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C17H28N2O/c1-6-19(12-14-8-7-9-15(18)11-14)16(20)10-13(2)17(3,4)5/h7-9,11,13H,6,10,12,18H2,1-5H3 |
| InChIKey | AOZXOERYOTUHLB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|