C18H26BrNO — CID 63833517
6-(1-bromo-3,4,4-trimethylpentyl)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 63833517) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is 6-(1-bromo-3,4,4-trimethylpentyl)-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(1-bromo-3,4,4-trimethylpentyl)-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 63833517 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 6-(1-bromo-3,4,4-trimethylpentyl)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CC(CC(Br)c1ccc2c(c1)CCC(=O)N2C)C(C)(C)C |
| InChI | InChI=1S/C18H26BrNO/c1-12(18(2,3)4)10-15(19)13-6-8-16-14(11-13)7-9-17(21)20(16)5/h6,8,11-12,15H,7,9-10H2,1-5H3 |
| InChIKey | VZZPZMXJXKEWLA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|