About 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid
3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 63834066) has the molecular formula C11H17F3N2O4
and a molecular weight of 298.26 g/mol. Its IUPAC name is 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 63834066 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)NCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H17F3N2O4/c1-10(8(17)18)2-4-16(6-10)9(19)15-3-5-20-7-11(12,13)14/h2-7H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | VVAYFSLZVQBGSA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid (CID 63834066) is 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid is CC1(C(=O)O)CCN(C(=O)NCCOCC(F)(F)F)C1.
What is the InChIKey of 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid?
The InChIKey is VVAYFSLZVQBGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O4/c1-10(8(17)18)2-4-16(6-10)9(19)15-3-5-20-7-11(12,13)14/h2-7H2,1H3,(H,15,19)(H,17,18).
What are the key properties of 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid?
3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid has a molecular weight of 298.26 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 63834066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).