C9H13F3N4O2 — CID 63834079
3-amino-5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-carboxamide (PubChem CID 63834079) has the molecular formula C9H13F3N4O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 3-amino-5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 3-amino-5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63834079 |
| Molecular Formula | C9H13F3N4O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-amino-5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]nc(N)c1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N4O2/c1-5-6(7(13)16-15-5)8(17)14-2-3-18-4-9(10,11)12/h2-4H2,1H3,(H,14,17)(H3,13,15,16) |
| InChIKey | OAOAJDZZRAAQJM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|