About N-(3-bromopropyl)-3,4,4-trimethylpentanamide
N-(3-bromopropyl)-3,4,4-trimethylpentanamide (PubChem CID 63834180) has the molecular formula C11H22BrNO
and a molecular weight of 264.21 g/mol. Its IUPAC name is N-(3-bromopropyl)-3,4,4-trimethylpentanamide.
Molecular Properties
| Compound Name | N-(3-bromopropyl)-3,4,4-trimethylpentanamide |
| PubChem CID | 63834180 |
| Molecular Formula | C11H22BrNO |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-(3-bromopropyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)NCCCBr)C(C)(C)C |
| InChI | InChI=1S/C11H22BrNO/c1-9(11(2,3)4)8-10(14)13-7-5-6-12/h9H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | VPDURLPKTVQEFR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-bromopropyl)-3,4,4-trimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromopropyl)-3,4,4-trimethylpentanamide?
The IUPAC name of N-(3-bromopropyl)-3,4,4-trimethylpentanamide (CID 63834180) is N-(3-bromopropyl)-3,4,4-trimethylpentanamide.
What is the SMILES notation for N-(3-bromopropyl)-3,4,4-trimethylpentanamide?
The canonical SMILES for N-(3-bromopropyl)-3,4,4-trimethylpentanamide is CC(CC(=O)NCCCBr)C(C)(C)C.
What is the InChIKey of N-(3-bromopropyl)-3,4,4-trimethylpentanamide?
The InChIKey is VPDURLPKTVQEFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22BrNO/c1-9(11(2,3)4)8-10(14)13-7-5-6-12/h9H,5-8H2,1-4H3,(H,13,14).
What are the key properties of N-(3-bromopropyl)-3,4,4-trimethylpentanamide?
N-(3-bromopropyl)-3,4,4-trimethylpentanamide has a molecular weight of 264.21 g/mol, XLogP of 2.96, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromopropyl)-3,4,4-trimethylpentanamide is sourced from PubChem (CID 63834180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).