C8H11F3N4O2 — CID 63834254
5-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-carboxamide (PubChem CID 63834254) has the molecular formula C8H11F3N4O2 and a molecular weight of 252.20 g/mol. Its IUPAC name is 5-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63834254 |
| Molecular Formula | C8H11F3N4O2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 5-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-carboxamide |
| SMILES | Nc1[nH]ncc1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O2/c9-8(10,11)4-17-2-1-13-7(16)5-3-14-15-6(5)12/h3H,1-2,4H2,(H,13,16)(H3,12,14,15) |
| InChIKey | PJCOROJJKTVDNL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|