C14H21ClN2O — CID 63834271
N-(5-amino-2-chlorophenyl)-3,4,4-trimethylpentanamide (PubChem CID 63834271) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is N-(5-amino-2-chlorophenyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(5-amino-2-chlorophenyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 63834271 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-(5-amino-2-chlorophenyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)Nc1cc(N)ccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C14H21ClN2O/c1-9(14(2,3)4)7-13(18)17-12-8-10(16)5-6-11(12)15/h5-6,8-9H,7,16H2,1-4H3,(H,17,18) |
| InChIKey | PPLPWBZXAIJWET-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|