C10H15F3N2O5 — CID 63834425
4-hydroxy-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 63834425) has the molecular formula C10H15F3N2O5 and a molecular weight of 300.23 g/mol. Its IUPAC name is 4-hydroxy-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-hydroxy-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 63834425 |
| Molecular Formula | C10H15F3N2O5 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-hydroxy-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O5/c11-10(12,13)5-20-2-1-14-9(19)15-4-6(16)3-7(15)8(17)18/h6-7,16H,1-5H2,(H,14,19)(H,17,18) |
| InChIKey | YJTIMNVFMWHKBG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|