C9H13F3N2O6 — CID 63834427
2-[carboxymethyl-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]amino]acetic acid (PubChem CID 63834427) has the molecular formula C9H13F3N2O6 and a molecular weight of 302.21 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 63834427 |
| Molecular Formula | C9H13F3N2O6 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[carboxymethyl-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O6/c10-9(11,12)5-20-2-1-13-8(19)14(3-6(15)16)4-7(17)18/h1-5H2,(H,13,19)(H,15,16)(H,17,18) |
| InChIKey | KSTSGIHRUHERMD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|