About 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide
2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide (PubChem CID 63834526) has the molecular formula C12H21F3N2O2
and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide |
| PubChem CID | 63834526 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide |
| SMILES | CC1CCCC(N)C1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O2/c1-8-3-2-4-9(16)10(8)11(18)17-5-6-19-7-12(13,14)15/h8-10H,2-7,16H2,1H3,(H,17,18) |
| InChIKey | SUTQDFNBPDZCOD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide?
The IUPAC name of 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide (CID 63834526) is 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide.
What is the SMILES notation for 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide?
The canonical SMILES for 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide is CC1CCCC(N)C1C(=O)NCCOCC(F)(F)F.
What is the InChIKey of 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide?
The InChIKey is SUTQDFNBPDZCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O2/c1-8-3-2-4-9(16)10(8)11(18)17-5-6-19-7-12(13,14)15/h8-10H,2-7,16H2,1H3,(H,17,18).
What are the key properties of 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide?
2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide has a molecular weight of 282.31 g/mol, XLogP of 1.45, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide is sourced from PubChem (CID 63834526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).