C11H17F3N2O5 — CID 63834597
4-methoxy-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 63834597) has the molecular formula C11H17F3N2O5 and a molecular weight of 314.26 g/mol. Its IUPAC name is 4-methoxy-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-methoxy-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 63834597 |
| Molecular Formula | C11H17F3N2O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-methoxy-1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | COC1CC(C(=O)O)N(C(=O)NCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H17F3N2O5/c1-20-7-4-8(9(17)18)16(5-7)10(19)15-2-3-21-6-11(12,13)14/h7-8H,2-6H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | OCGUEEWLTPZGFF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|