C12H21F3N2O4 — CID 63834772
4-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]amino]butanoic acid (PubChem CID 63834772) has the molecular formula C12H21F3N2O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]amino]butanoic acid.
| Compound Name | 4-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 63834772 |
| Molecular Formula | C12H21F3N2O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-[propan-2-yl-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]amino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O4/c1-9(2)17(6-3-4-10(18)19)11(20)16-5-7-21-8-12(13,14)15/h9H,3-8H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | HCZWHMYDGQUIQR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|