C15H18N2O3S — CID 63834938
ethyl 2-[4-(hydroxymethyl)-3-methyl-1-phenylpyrazol-5-yl]sulfanylacetate (PubChem CID 63834938) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 2-[4-(hydroxymethyl)-3-methyl-1-phenylpyrazol-5-yl]sulfanylacetate.
| Compound Name | ethyl 2-[4-(hydroxymethyl)-3-methyl-1-phenylpyrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 63834938 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 2-[4-(hydroxymethyl)-3-methyl-1-phenylpyrazol-5-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1c(CO)c(C)nn1-c1ccccc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-3-20-14(19)10-21-15-13(9-18)11(2)16-17(15)12-7-5-4-6-8-12/h4-8,18H,3,9-10H2,1-2H3 |
| InChIKey | VHUSTWXLVDAKRL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |