About CID 6383512
CID 6383512 (PubChem CID 6383512) has the molecular formula H2O6PbV2
and a molecular weight of 407.10 g/mol.
Molecular Properties
| Compound Name | CID 6383512 |
| PubChem CID | 6383512 |
| Molecular Formula | H2O6PbV2 |
| Molecular Weight | 407.10 g/mol |
| Exact Mass | 407.85 |
| IUPAC Name | — |
| SMILES | O=[V](=O)O.O=[V](=O)O.[Pb] |
| InChI | InChI=1S/2H2O.4O.Pb.2V/h2*1H2;;;;;;;/q;;;;;;;2*+1/p-2 |
| InChIKey | PDVYBDATUOUQJF-UHFFFAOYSA-L |
| XLogP | -1.98 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.10 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 6383512 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6383512?
The IUPAC name of CID 6383512 (CID 6383512) is not available.
What is the SMILES notation for CID 6383512?
The canonical SMILES for CID 6383512 is O=[V](=O)O.O=[V](=O)O.[Pb].
What is the InChIKey of CID 6383512?
The InChIKey is PDVYBDATUOUQJF-UHFFFAOYSA-L. The full InChI is InChI=1S/2H2O.4O.Pb.2V/h2*1H2;;;;;;;/q;;;;;;;2*+1/p-2.
What are the key properties of CID 6383512?
CID 6383512 has a molecular weight of 407.10 g/mol, XLogP of -1.98, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6383512 is sourced from PubChem (CID 6383512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).