C14H18N2OS — CID 63835845
(2-cyclohexylsulfanylimidazo[1,2-a]pyridin-3-yl)methanol (PubChem CID 63835845) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is (2-cyclohexylsulfanylimidazo[1,2-a]pyridin-3-yl)methanol.
| Compound Name | (2-cyclohexylsulfanylimidazo[1,2-a]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 63835845 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2-cyclohexylsulfanylimidazo[1,2-a]pyridin-3-yl)methanol |
| SMILES | OCc1c(SC2CCCCC2)nc2ccccn12 |
| InChI | InChI=1S/C14H18N2OS/c17-10-12-14(18-11-6-2-1-3-7-11)15-13-8-4-5-9-16(12)13/h4-5,8-9,11,17H,1-3,6-7,10H2 |
| InChIKey | JYWXRZKRKHNWBR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |