About 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one
3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one (PubChem CID 63835918) has the molecular formula C14H10N2O4S
and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one |
| PubChem CID | 63835918 |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(Sc3ccccc3[N+](=O)[O-])ccc2C1O |
| InChI | InChI=1S/C14H10N2O4S/c17-13-9-6-5-8(7-10(9)15-14(13)18)21-12-4-2-1-3-11(12)16(19)20/h1-7,13,17H,(H,15,18) |
| InChIKey | IKVMMMWPEFCRFY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one?
The IUPAC name of 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one (CID 63835918) is 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one?
The canonical SMILES for 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one is O=C1Nc2cc(Sc3ccccc3[N+](=O)[O-])ccc2C1O.
What is the InChIKey of 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one?
The InChIKey is IKVMMMWPEFCRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O4S/c17-13-9-6-5-8(7-10(9)15-14(13)18)21-12-4-2-1-3-11(12)16(19)20/h1-7,13,17H,(H,15,18).
What are the key properties of 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one?
3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one has a molecular weight of 302.31 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6-(2-nitrophenyl)sulfanyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 63835918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).