C14H15IN2OS — CID 63838016
1-(4-iodophenyl)-2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethanone (PubChem CID 63838016) has the molecular formula C14H15IN2OS and a molecular weight of 386.26 g/mol. Its IUPAC name is 1-(4-iodophenyl)-2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethanone.
| Compound Name | 1-(4-iodophenyl)-2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethanone |
|---|---|
| PubChem CID | 63838016 |
| Molecular Formula | C14H15IN2OS |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1-(4-iodophenyl)-2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethanone |
| SMILES | Cc1ncsc1CN(C)CC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H15IN2OS/c1-10-14(19-9-16-10)8-17(2)7-13(18)11-3-5-12(15)6-4-11/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | AWXCCZUBCHYBQQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|