About 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline
1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 6383807) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline.
Molecular Properties
| Compound Name | 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline |
| PubChem CID | 6383807 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | C/C=C/c1nnc2ccc3ccccc3n12 |
| InChI | InChI=1S/C13H11N3/c1-2-5-12-14-15-13-9-8-10-6-3-4-7-11(10)16(12)13/h2-9H,1H3/b5-2+ |
| InChIKey | WSDULWVQFQINFD-GORDUTHDSA-N |
| XLogP | 2.92 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline?
The IUPAC name of 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline (CID 6383807) is 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline.
What is the SMILES notation for 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline?
The canonical SMILES for 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline is C/C=C/c1nnc2ccc3ccccc3n12.
What is the InChIKey of 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline?
The InChIKey is WSDULWVQFQINFD-GORDUTHDSA-N. The full InChI is InChI=1S/C13H11N3/c1-2-5-12-14-15-13-9-8-10-6-3-4-7-11(10)16(12)13/h2-9H,1H3/b5-2+.
What are the key properties of 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline?
1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline has a molecular weight of 209.25 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-prop-1-enyl]-[1,2,4]triazolo[4,3-a]quinoline is sourced from PubChem (CID 6383807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).