About N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine
N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine (PubChem CID 63838966) has the molecular formula C12H23N3OS
and a molecular weight of 257.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine |
| PubChem CID | 63838966 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine |
| SMILES | COCCNCCCN(C)Cc1scnc1C |
| InChI | InChI=1S/C12H23N3OS/c1-11-12(17-10-14-11)9-15(2)7-4-5-13-6-8-16-3/h10,13H,4-9H2,1-3H3 |
| InChIKey | ZEYKWWHWKSOUIN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine?
The IUPAC name of N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine (CID 63838966) is N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine.
What is the SMILES notation for N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine?
The canonical SMILES for N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine is COCCNCCCN(C)Cc1scnc1C.
What is the InChIKey of N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine?
The InChIKey is ZEYKWWHWKSOUIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3OS/c1-11-12(17-10-14-11)9-15(2)7-4-5-13-6-8-16-3/h10,13H,4-9H2,1-3H3.
What are the key properties of N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine?
N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine has a molecular weight of 257.40 g/mol, XLogP of 1.51, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine is sourced from PubChem (CID 63838966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).