C13H17N3O3 — CID 63839306
5-(diethoxymethyl)-3-(4-methyl-2-pyridinyl)-1,2,4-oxadiazole (PubChem CID 63839306) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-(4-methyl-2-pyridinyl)-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-(4-methyl-2-pyridinyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63839306 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5-(diethoxymethyl)-3-(4-methyl-2-pyridinyl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(-c2cc(C)ccn2)no1 |
| InChI | InChI=1S/C13H17N3O3/c1-4-17-13(18-5-2)12-15-11(16-19-12)10-8-9(3)6-7-14-10/h6-8,13H,4-5H2,1-3H3 |
| InChIKey | PDEOBLHTJLALDF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|