About [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol
[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol (PubChem CID 63839657) has the molecular formula C10H13N3OS2
and a molecular weight of 255.37 g/mol. Its IUPAC name is [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol |
| PubChem CID | 63839657 |
| Molecular Formula | C10H13N3OS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol |
| SMILES | Cc1ncsc1CN(C)c1ncc(CO)s1 |
| InChI | InChI=1S/C10H13N3OS2/c1-7-9(15-6-12-7)4-13(2)10-11-3-8(5-14)16-10/h3,6,14H,4-5H2,1-2H3 |
| InChIKey | SBQBSNSEMGDDFF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol (CID 63839657) is [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol is Cc1ncsc1CN(C)c1ncc(CO)s1.
What is the InChIKey of [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol?
The InChIKey is SBQBSNSEMGDDFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS2/c1-7-9(15-6-12-7)4-13(2)10-11-3-8(5-14)16-10/h3,6,14H,4-5H2,1-2H3.
What are the key properties of [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol?
[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol has a molecular weight of 255.37 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 63839657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).