About 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide
3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide (PubChem CID 63840300) has the molecular formula C10H18N4OS
and a molecular weight of 242.35 g/mol. Its IUPAC name is 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide.
Molecular Properties
| Compound Name | 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide |
| PubChem CID | 63840300 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide |
| SMILES | Cc1ncsc1CN(C)C(C)CC(=O)NN |
| InChI | InChI=1S/C10H18N4OS/c1-7(4-10(15)13-11)14(3)5-9-8(2)12-6-16-9/h6-7H,4-5,11H2,1-3H3,(H,13,15) |
| InChIKey | QXVUZJPYYUFMGC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide?
The IUPAC name of 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide (CID 63840300) is 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide.
What is the SMILES notation for 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide?
The canonical SMILES for 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide is Cc1ncsc1CN(C)C(C)CC(=O)NN.
What is the InChIKey of 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide?
The InChIKey is QXVUZJPYYUFMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4OS/c1-7(4-10(15)13-11)14(3)5-9-8(2)12-6-16-9/h6-7H,4-5,11H2,1-3H3,(H,13,15).
What are the key properties of 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide?
3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide has a molecular weight of 242.35 g/mol, XLogP of 0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]butanehydrazide is sourced from PubChem (CID 63840300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).