About (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine
(NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 6384068) has the molecular formula C11H15N5OS
and a molecular weight of 265.34 g/mol. Its IUPAC name is (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| PubChem CID | 6384068 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | Nc1cc(N)nc(SC2/C(=N/O)C3CCC2C3)n1 |
| InChI | InChI=1S/C11H15N5OS/c12-7-4-8(13)15-11(14-7)18-10-6-2-1-5(3-6)9(10)16-17/h4-6,10,17H,1-3H2,(H4,12,13,14,15)/b16-9+ |
| InChIKey | ZLASKWGKWNXUTG-CXUHLZMHSA-N |
| XLogP | 1.36 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine?
The IUPAC name of (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (CID 6384068) is (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine is Nc1cc(N)nc(SC2/C(=N/O)C3CCC2C3)n1.
What is the InChIKey of (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine?
The InChIKey is ZLASKWGKWNXUTG-CXUHLZMHSA-N. The full InChI is InChI=1S/C11H15N5OS/c12-7-4-8(13)15-11(14-7)18-10-6-2-1-5(3-6)9(10)16-17/h4-6,10,17H,1-3H2,(H4,12,13,14,15)/b16-9+.
What are the key properties of (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine?
(NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine has a molecular weight of 265.34 g/mol, XLogP of 1.36, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine is sourced from PubChem (CID 6384068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).