About 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol
3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 63844927) has the molecular formula C12H14N2O3
and a molecular weight of 234.26 g/mol. Its IUPAC name is 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol.
Molecular Properties
| Compound Name | 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol |
| PubChem CID | 63844927 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CCCOCc1noc(-c2cccc(O)c2)n1 |
| InChI | InChI=1S/C12H14N2O3/c1-2-6-16-8-11-13-12(17-14-11)9-4-3-5-10(15)7-9/h3-5,7,15H,2,6,8H2,1H3 |
| InChIKey | BOOWGLLILQQAEH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol?
The IUPAC name of 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol (CID 63844927) is 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol.
What is the SMILES notation for 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol?
The canonical SMILES for 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol is CCCOCc1noc(-c2cccc(O)c2)n1.
What is the InChIKey of 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol?
The InChIKey is BOOWGLLILQQAEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-2-6-16-8-11-13-12(17-14-11)9-4-3-5-10(15)7-9/h3-5,7,15H,2,6,8H2,1H3.
What are the key properties of 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol?
3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol has a molecular weight of 234.26 g/mol, XLogP of 2.37, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]phenol is sourced from PubChem (CID 63844927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).