C13H6F3N3O2 — CID 63845790
5-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol (PubChem CID 63845790) has the molecular formula C13H6F3N3O2 and a molecular weight of 293.20 g/mol. Its IUPAC name is 5-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol.
| Compound Name | 5-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 63845790 |
| Molecular Formula | C13H6F3N3O2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 5-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
| SMILES | Oc1cncc(-c2nc(-c3cc(F)c(F)c(F)c3)no2)c1 |
| InChI | InChI=1S/C13H6F3N3O2/c14-9-2-6(3-10(15)11(9)16)12-18-13(21-19-12)7-1-8(20)5-17-4-7/h1-5,20H |
| InChIKey | XXFYFLFSXHWCNQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|