C15H31N3O2 — CID 63847458
4-[3-[(2-methoxyethylamino)methyl]piperidin-1-yl]-N,N-dimethylbutanamide (PubChem CID 63847458) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is 4-[3-[(2-methoxyethylamino)methyl]piperidin-1-yl]-N,N-dimethylbutanamide.
| Compound Name | 4-[3-[(2-methoxyethylamino)methyl]piperidin-1-yl]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 63847458 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | 4-[3-[(2-methoxyethylamino)methyl]piperidin-1-yl]-N,N-dimethylbutanamide |
| SMILES | COCCNCC1CCCN(CCCC(=O)N(C)C)C1 |
| InChI | InChI=1S/C15H31N3O2/c1-17(2)15(19)7-5-10-18-9-4-6-14(13-18)12-16-8-11-20-3/h14,16H,4-13H2,1-3H3 |
| InChIKey | PNSDSNZLYYNLOW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|