About 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid
5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid (PubChem CID 63850823) has the molecular formula C13H9N3O5
and a molecular weight of 287.23 g/mol. Its IUPAC name is 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid |
| PubChem CID | 63850823 |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(OCc2nc(-c3ccco3)no2)c1 |
| InChI | InChI=1S/C13H9N3O5/c17-13(18)8-4-9(6-14-5-8)20-7-11-15-12(16-21-11)10-2-1-3-19-10/h1-6H,7H2,(H,17,18) |
| InChIKey | OLGODQBQNDBUTO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid?
The IUPAC name of 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid (CID 63850823) is 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid.
What is the SMILES notation for 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid?
The canonical SMILES for 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid is O=C(O)c1cncc(OCc2nc(-c3ccco3)no2)c1.
What is the InChIKey of 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid?
The InChIKey is OLGODQBQNDBUTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O5/c17-13(18)8-4-9(6-14-5-8)20-7-11-15-12(16-21-11)10-2-1-3-19-10/h1-6H,7H2,(H,17,18).
What are the key properties of 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid?
5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid has a molecular weight of 287.23 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methoxy]pyridine-3-carboxylic acid is sourced from PubChem (CID 63850823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).