C11H8FN3O — CID 63851831
3-[(5-fluoroindol-1-yl)methyl]-1,2,4-oxadiazole (PubChem CID 63851831) has the molecular formula C11H8FN3O and a molecular weight of 217.20 g/mol. Its IUPAC name is 3-[(5-fluoroindol-1-yl)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[(5-fluoroindol-1-yl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63851831 |
| Molecular Formula | C11H8FN3O |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-[(5-fluoroindol-1-yl)methyl]-1,2,4-oxadiazole |
| SMILES | Fc1ccc2c(ccn2Cc2ncon2)c1 |
| InChI | InChI=1S/C11H8FN3O/c12-9-1-2-10-8(5-9)3-4-15(10)6-11-13-7-16-14-11/h1-5,7H,6H2 |
| InChIKey | XKTZQKFAMXIJEO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |