About 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid
5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid (PubChem CID 63852585) has the molecular formula C10H7ClN4O4
and a molecular weight of 282.64 g/mol. Its IUPAC name is 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid |
| PubChem CID | 63852585 |
| Molecular Formula | C10H7ClN4O4 |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid |
| SMILES | COc1nc(Cl)nc(Oc2cncc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C10H7ClN4O4/c1-18-9-13-8(11)14-10(15-9)19-6-2-5(7(16)17)3-12-4-6/h2-4H,1H3,(H,16,17) |
| InChIKey | VFNAAYOPWDMNNG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid?
The IUPAC name of 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid (CID 63852585) is 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid.
What is the SMILES notation for 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid?
The canonical SMILES for 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid is COc1nc(Cl)nc(Oc2cncc(C(=O)O)c2)n1.
What is the InChIKey of 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid?
The InChIKey is VFNAAYOPWDMNNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN4O4/c1-18-9-13-8(11)14-10(15-9)19-6-2-5(7(16)17)3-12-4-6/h2-4H,1H3,(H,16,17).
What are the key properties of 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid?
5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid has a molecular weight of 282.64 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]pyridine-3-carboxylic acid is sourced from PubChem (CID 63852585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).