About N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide
N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 63858455) has the molecular formula C7H16F2N2O2S
and a molecular weight of 230.28 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide |
| PubChem CID | 63858455 |
| Molecular Formula | C7H16F2N2O2S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNCC(F)F)NS(C)(=O)=O |
| InChI | InChI=1S/C7H16F2N2O2S/c1-7(2,11-14(3,12)13)5-10-4-6(8)9/h6,10-11H,4-5H2,1-3H3 |
| InChIKey | SQSAVDQGHBJDMN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide?
The IUPAC name of N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide (CID 63858455) is N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide?
The canonical SMILES for N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide is CC(C)(CNCC(F)F)NS(C)(=O)=O.
What is the InChIKey of N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide?
The InChIKey is SQSAVDQGHBJDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16F2N2O2S/c1-7(2,11-14(3,12)13)5-10-4-6(8)9/h6,10-11H,4-5H2,1-3H3.
What are the key properties of N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide?
N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide has a molecular weight of 230.28 g/mol, XLogP of 0.17, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,2-difluoroethylamino)-2-methylpropan-2-yl]methanesulfonamide is sourced from PubChem (CID 63858455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).