C12H23N3O2S — CID 63859503
N-[1-[(2-cyanocyclohexyl)amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 63859503) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-[1-[(2-cyanocyclohexyl)amino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(2-cyanocyclohexyl)amino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 63859503 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[1-[(2-cyanocyclohexyl)amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNC1CCCCC1C#N)NS(C)(=O)=O |
| InChI | InChI=1S/C12H23N3O2S/c1-12(2,15-18(3,16)17)9-14-11-7-5-4-6-10(11)8-13/h10-11,14-15H,4-7,9H2,1-3H3 |
| InChIKey | RVDSSYAVTHQKPZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |