About N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide
N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 63860747) has the molecular formula C12H22N4O4S
and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide |
| PubChem CID | 63860747 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | Cn1c(CNCC(C)(C)NS(C)(=O)=O)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C12H22N4O4S/c1-12(2,14-21(5,19)20)8-13-7-9-6-10(17)16(4)11(18)15(9)3/h6,13-14H,7-8H2,1-5H3 |
| InChIKey | JPMBCBWURGVNKW-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide?
The IUPAC name of N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide (CID 63860747) is N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide?
The canonical SMILES for N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide is Cn1c(CNCC(C)(C)NS(C)(=O)=O)cc(=O)n(C)c1=O.
What is the InChIKey of N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide?
The InChIKey is JPMBCBWURGVNKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O4S/c1-12(2,14-21(5,19)20)8-13-7-9-6-10(17)16(4)11(18)15(9)3/h6,13-14H,7-8H2,1-5H3.
What are the key properties of N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide?
N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide has a molecular weight of 318.40 g/mol, XLogP of -1.50, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide is sourced from PubChem (CID 63860747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).