About N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide
N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 63860954) has the molecular formula C12H16F2N4O2S
and a molecular weight of 318.35 g/mol. Its IUPAC name is N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide |
| PubChem CID | 63860954 |
| Molecular Formula | C12H16F2N4O2S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)(Cn1c(N)nc2ccc(F)c(F)c21)NS(C)(=O)=O |
| InChI | InChI=1S/C12H16F2N4O2S/c1-12(2,17-21(3,19)20)6-18-10-8(16-11(18)15)5-4-7(13)9(10)14/h4-5,17H,6H2,1-3H3,(H2,15,16) |
| InChIKey | XMQOACFTZJMBHM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide?
The IUPAC name of N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide (CID 63860954) is N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide?
The canonical SMILES for N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide is CC(C)(Cn1c(N)nc2ccc(F)c(F)c21)NS(C)(=O)=O.
What is the InChIKey of N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide?
The InChIKey is XMQOACFTZJMBHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N4O2S/c1-12(2,17-21(3,19)20)6-18-10-8(16-11(18)15)5-4-7(13)9(10)14/h4-5,17H,6H2,1-3H3,(H2,15,16).
What are the key properties of N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide?
N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide has a molecular weight of 318.35 g/mol, XLogP of 1.22, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-amino-6,7-difluorobenzimidazol-1-yl)-2-methylpropan-2-yl]methanesulfonamide is sourced from PubChem (CID 63860954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).