C12H21N3O4S2 — CID 63862103
3-amino-N-[2-(methanesulfonamido)-2-methylpropyl]-5-methylbenzenesulfonamide (PubChem CID 63862103) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-amino-N-[2-(methanesulfonamido)-2-methylpropyl]-5-methylbenzenesulfonamide.
| Compound Name | 3-amino-N-[2-(methanesulfonamido)-2-methylpropyl]-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 63862103 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-amino-N-[2-(methanesulfonamido)-2-methylpropyl]-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)NCC(C)(C)NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H21N3O4S2/c1-9-5-10(13)7-11(6-9)21(18,19)14-8-12(2,3)15-20(4,16)17/h5-7,14-15H,8,13H2,1-4H3 |
| InChIKey | FIBDXLDZFNGRGC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|