C14H19BF3O- — CID 63862168
[3-(2-ethylcyclohexyl)oxyphenyl]-trifluoroboranuide (PubChem CID 63862168) has the molecular formula C14H19BF3O- and a molecular weight of 271.11 g/mol. Its IUPAC name is [3-(2-ethylcyclohexyl)oxyphenyl]-trifluoroboranuide.
| Compound Name | [3-(2-ethylcyclohexyl)oxyphenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 63862168 |
| Molecular Formula | C14H19BF3O- |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | [3-(2-ethylcyclohexyl)oxyphenyl]-trifluoroboranuide |
| SMILES | CCC1CCCCC1Oc1cccc([B-](F)(F)F)c1 |
| InChI | InChI=1S/C14H19BF3O/c1-2-11-6-3-4-9-14(11)19-13-8-5-7-12(10-13)15(16,17)18/h5,7-8,10-11,14H,2-4,6,9H2,1H3/q-1 |
| InChIKey | LTOCTDZXQHGIQG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|