C14H23N5O — CID 63862625
5-hydrazinyl-N-methyl-N-[(2-methylcyclopropyl)methyl]-2-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 63862625) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-hydrazinyl-N-methyl-N-[(2-methylcyclopropyl)methyl]-2-propan-2-ylpyrimidine-4-carboxamide.
| Compound Name | 5-hydrazinyl-N-methyl-N-[(2-methylcyclopropyl)methyl]-2-propan-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 63862625 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 5-hydrazinyl-N-methyl-N-[(2-methylcyclopropyl)methyl]-2-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | CC(C)c1ncc(NN)c(C(=O)N(C)CC2CC2C)n1 |
| InChI | InChI=1S/C14H23N5O/c1-8(2)13-16-6-11(18-15)12(17-13)14(20)19(4)7-10-5-9(10)3/h6,8-10,18H,5,7,15H2,1-4H3 |
| InChIKey | UPBHEBYBVPSRBH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|