About Dimethyl(2,3,6-trichlorophenyl)silane
Dimethyl(2,3,6-trichlorophenyl)silane (PubChem CID 6386274) has the molecular formula C8H8Cl3Si
and a molecular weight of 238.60 g/mol.
Molecular Properties
| Compound Name | Dimethyl(2,3,6-trichlorophenyl)silane |
| PubChem CID | 6386274 |
| Molecular Formula | C8H8Cl3Si |
| Molecular Weight | 238.60 g/mol |
| Exact Mass | 236.95 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl3Si/c1-12(2)8-6(10)4-3-5(9)7(8)11/h3-4H,1-2H3 |
| InChIKey | ZVKIBSMEFCJNPV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Dimethyl(2,3,6-trichlorophenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dimethyl(2,3,6-trichlorophenyl)silane?
The IUPAC name of Dimethyl(2,3,6-trichlorophenyl)silane (CID 6386274) is not available.
What is the SMILES notation for Dimethyl(2,3,6-trichlorophenyl)silane?
The canonical SMILES for Dimethyl(2,3,6-trichlorophenyl)silane is C[Si](C)c1c(Cl)ccc(Cl)c1Cl.
What is the InChIKey of Dimethyl(2,3,6-trichlorophenyl)silane?
The InChIKey is ZVKIBSMEFCJNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl3Si/c1-12(2)8-6(10)4-3-5(9)7(8)11/h3-4H,1-2H3.
What are the key properties of Dimethyl(2,3,6-trichlorophenyl)silane?
Dimethyl(2,3,6-trichlorophenyl)silane has a molecular weight of 238.60 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Dimethyl(2,3,6-trichlorophenyl)silane is sourced from PubChem (CID 6386274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).