About N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide
N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 63863549) has the molecular formula C10H21N5O2S
and a molecular weight of 275.38 g/mol. Its IUPAC name is N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
| PubChem CID | 63863549 |
| Molecular Formula | C10H21N5O2S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | Cc1nn(C)c(NCC(C)(C)NS(C)(=O)=O)c1N |
| InChI | InChI=1S/C10H21N5O2S/c1-7-8(11)9(15(4)13-7)12-6-10(2,3)14-18(5,16)17/h12,14H,6,11H2,1-5H3 |
| InChIKey | RFEGTUTVXXXMJS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide?
The IUPAC name of N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide (CID 63863549) is N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide?
The canonical SMILES for N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide is Cc1nn(C)c(NCC(C)(C)NS(C)(=O)=O)c1N.
What is the InChIKey of N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide?
The InChIKey is RFEGTUTVXXXMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N5O2S/c1-7-8(11)9(15(4)13-7)12-6-10(2,3)14-18(5,16)17/h12,14H,6,11H2,1-5H3.
What are the key properties of N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide?
N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide has a molecular weight of 275.38 g/mol, XLogP of 0.05, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropan-2-yl]methanesulfonamide is sourced from PubChem (CID 63863549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).