About N-(2-ethylcyclohexyl)-3,5-dimethylaniline
N-(2-ethylcyclohexyl)-3,5-dimethylaniline (PubChem CID 63863762) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is N-(2-ethylcyclohexyl)-3,5-dimethylaniline.
Molecular Properties
| Compound Name | N-(2-ethylcyclohexyl)-3,5-dimethylaniline |
| PubChem CID | 63863762 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-(2-ethylcyclohexyl)-3,5-dimethylaniline |
| SMILES | CCC1CCCCC1Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H25N/c1-4-14-7-5-6-8-16(14)17-15-10-12(2)9-13(3)11-15/h9-11,14,16-17H,4-8H2,1-3H3 |
| InChIKey | XOERPJACEIPENX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-ethylcyclohexyl)-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethylcyclohexyl)-3,5-dimethylaniline?
The IUPAC name of N-(2-ethylcyclohexyl)-3,5-dimethylaniline (CID 63863762) is N-(2-ethylcyclohexyl)-3,5-dimethylaniline.
What is the SMILES notation for N-(2-ethylcyclohexyl)-3,5-dimethylaniline?
The canonical SMILES for N-(2-ethylcyclohexyl)-3,5-dimethylaniline is CCC1CCCCC1Nc1cc(C)cc(C)c1.
What is the InChIKey of N-(2-ethylcyclohexyl)-3,5-dimethylaniline?
The InChIKey is XOERPJACEIPENX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N/c1-4-14-7-5-6-8-16(14)17-15-10-12(2)9-13(3)11-15/h9-11,14,16-17H,4-8H2,1-3H3.
What are the key properties of N-(2-ethylcyclohexyl)-3,5-dimethylaniline?
N-(2-ethylcyclohexyl)-3,5-dimethylaniline has a molecular weight of 231.38 g/mol, XLogP of 4.68, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethylcyclohexyl)-3,5-dimethylaniline is sourced from PubChem (CID 63863762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).