About 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline
4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline (PubChem CID 63864840) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline.
Molecular Properties
| Compound Name | 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline |
| PubChem CID | 63864840 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline |
| SMILES | CCNCc1ccc(N(C)CC2CC2C)cc1C |
| InChI | InChI=1S/C16H26N2/c1-5-17-10-14-6-7-16(9-13(14)3)18(4)11-15-8-12(15)2/h6-7,9,12,15,17H,5,8,10-11H2,1-4H3 |
| InChIKey | DFMFFOCELPXQNM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline?
The IUPAC name of 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline (CID 63864840) is 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline.
What is the SMILES notation for 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline?
The canonical SMILES for 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline is CCNCc1ccc(N(C)CC2CC2C)cc1C.
What is the InChIKey of 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline?
The InChIKey is DFMFFOCELPXQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2/c1-5-17-10-14-6-7-16(9-13(14)3)18(4)11-15-8-12(15)2/h6-7,9,12,15,17H,5,8,10-11H2,1-4H3.
What are the key properties of 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline?
4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline has a molecular weight of 246.40 g/mol, XLogP of 3.20, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylaminomethyl)-N,3-dimethyl-N-[(2-methylcyclopropyl)methyl]aniline is sourced from PubChem (CID 63864840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).