About 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone
1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone (PubChem CID 638658) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone |
| PubChem CID | 638658 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone |
| SMILES | CC(=O)c1n[nH]c(C(C)=O)n1 |
| InChI | InChI=1S/C6H7N3O2/c1-3(10)5-7-6(4(2)11)9-8-5/h1-2H3,(H,7,8,9) |
| InChIKey | BSENWGNTNMQPEQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone?
The IUPAC name of 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone (CID 638658) is 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone.
What is the SMILES notation for 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone?
The canonical SMILES for 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone is CC(=O)c1n[nH]c(C(C)=O)n1.
What is the InChIKey of 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone?
The InChIKey is BSENWGNTNMQPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c1-3(10)5-7-6(4(2)11)9-8-5/h1-2H3,(H,7,8,9).
What are the key properties of 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone?
1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone has a molecular weight of 153.14 g/mol, XLogP of 0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-acetyl-1H-1,2,4-triazol-5-yl)ethanone is sourced from PubChem (CID 638658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).