C16H21FN2 — CID 63865908
3-[5-fluoro-2-[[methyl-[(2-methylcyclopropyl)methyl]amino]methyl]phenyl]prop-2-yn-1-amine (PubChem CID 63865908) has the molecular formula C16H21FN2 and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-[5-fluoro-2-[[methyl-[(2-methylcyclopropyl)methyl]amino]methyl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[5-fluoro-2-[[methyl-[(2-methylcyclopropyl)methyl]amino]methyl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 63865908 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 3-[5-fluoro-2-[[methyl-[(2-methylcyclopropyl)methyl]amino]methyl]phenyl]prop-2-yn-1-amine |
| SMILES | CC1CC1CN(C)Cc1ccc(F)cc1C#CCN |
| InChI | InChI=1S/C16H21FN2/c1-12-8-15(12)11-19(2)10-14-5-6-16(17)9-13(14)4-3-7-18/h5-6,9,12,15H,7-8,10-11,18H2,1-2H3 |
| InChIKey | CESUAYAFZNXVCL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|