About N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine
N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine (PubChem CID 63865981) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine |
| PubChem CID | 63865981 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine |
| SMILES | CC1CC1CN(C)CCNc1ccccc1 |
| InChI | InChI=1S/C14H22N2/c1-12-10-13(12)11-16(2)9-8-15-14-6-4-3-5-7-14/h3-7,12-13,15H,8-11H2,1-2H3 |
| InChIKey | KEBXDQZCTHZRDT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine?
The IUPAC name of N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine (CID 63865981) is N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine?
The canonical SMILES for N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine is CC1CC1CN(C)CCNc1ccccc1.
What is the InChIKey of N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine?
The InChIKey is KEBXDQZCTHZRDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2/c1-12-10-13(12)11-16(2)9-8-15-14-6-4-3-5-7-14/h3-7,12-13,15H,8-11H2,1-2H3.
What are the key properties of N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine?
N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine has a molecular weight of 218.34 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[(2-methylcyclopropyl)methyl]-N-phenylethane-1,2-diamine is sourced from PubChem (CID 63865981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).